C20H30N2O7 — CID 90393911
5-[[2,6-dimethoxy-4-[5-(methylamino)-5-oxopentoxy]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 90393911) has the molecular formula C20H30N2O7 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[[2,6-dimethoxy-4-[5-(methylamino)-5-oxopentoxy]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[2,6-dimethoxy-4-[5-(methylamino)-5-oxopentoxy]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90393911 |
| Molecular Formula | C20H30N2O7 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[[2,6-dimethoxy-4-[5-(methylamino)-5-oxopentoxy]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | CNC(=O)CCCCOc1cc(OC)c(CNC(=O)CCCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C20H30N2O7/c1-21-18(23)7-4-5-10-29-14-11-16(27-2)15(17(12-14)28-3)13-22-19(24)8-6-9-20(25)26/h11-12H,4-10,13H2,1-3H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | IWTULOUKJPKCBA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|