C15H25N2O4P — CID 20680981
4-[3-methoxy-5-methyl-4-[[methyl(phosphanyloxy)amino]methyl]phenoxy]-N-methylbutanamide (PubChem CID 20680981) has the molecular formula C15H25N2O4P and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-[3-methoxy-5-methyl-4-[[methyl(phosphanyloxy)amino]methyl]phenoxy]-N-methylbutanamide.
| Compound Name | 4-[3-methoxy-5-methyl-4-[[methyl(phosphanyloxy)amino]methyl]phenoxy]-N-methylbutanamide |
|---|---|
| PubChem CID | 20680981 |
| Molecular Formula | C15H25N2O4P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[3-methoxy-5-methyl-4-[[methyl(phosphanyloxy)amino]methyl]phenoxy]-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1cc(C)c(CN(C)OP)c(OC)c1 |
| InChI | InChI=1S/C15H25N2O4P/c1-11-8-12(20-7-5-6-15(18)16-2)9-14(19-4)13(11)10-17(3)21-22/h8-9H,5-7,10,22H2,1-4H3,(H,16,18) |
| InChIKey | CFJZFZVYYQGGSD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|