About [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate
[4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate (PubChem CID 63890602) has the molecular formula C14H20N2O5
and a molecular weight of 296.32 g/mol. Its IUPAC name is [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate |
| PubChem CID | 63890602 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate |
| SMILES | CNC(=O)CCCOC(=O)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C14H20N2O5/c1-16-13(17)5-4-6-21-14(18)9-7-11(19-2)12(20-3)8-10(9)15/h7-8H,4-6,15H2,1-3H3,(H,16,17) |
| InChIKey | YKXSSKAYJKODRV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate?
The IUPAC name of [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate (CID 63890602) is [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate.
What is the SMILES notation for [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate?
The canonical SMILES for [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate is CNC(=O)CCCOC(=O)c1cc(OC)c(OC)cc1N.
What is the InChIKey of [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate?
The InChIKey is YKXSSKAYJKODRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O5/c1-16-13(17)5-4-6-21-14(18)9-7-11(19-2)12(20-3)8-10(9)15/h7-8H,4-6,15H2,1-3H3,(H,16,17).
What are the key properties of [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate?
[4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate has a molecular weight of 296.32 g/mol, XLogP of 0.97, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate is sourced from PubChem (CID 63890602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).