C14H20N2O5 — CID 63890602
[4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate (PubChem CID 63890602) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate.
| Compound Name | [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 63890602 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [4-(methylamino)-4-oxobutyl] 2-amino-4,5-dimethoxybenzoate |
| SMILES | CNC(=O)CCCOC(=O)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C14H20N2O5/c1-16-13(17)5-4-6-21-14(18)9-7-11(19-2)12(20-3)8-10(9)15/h7-8H,4-6,15H2,1-3H3,(H,16,17) |
| InChIKey | YKXSSKAYJKODRV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|