C12H14F2N2O3 — CID 63891251
[4-(methylamino)-4-oxobutyl] 5-amino-2,4-difluorobenzoate (PubChem CID 63891251) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is [4-(methylamino)-4-oxobutyl] 5-amino-2,4-difluorobenzoate.
| Compound Name | [4-(methylamino)-4-oxobutyl] 5-amino-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 63891251 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [4-(methylamino)-4-oxobutyl] 5-amino-2,4-difluorobenzoate |
| SMILES | CNC(=O)CCCOC(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O3/c1-16-11(17)3-2-4-19-12(18)7-5-10(15)9(14)6-8(7)13/h5-6H,2-4,15H2,1H3,(H,16,17) |
| InChIKey | ZTHHNPJMHZUJKV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|