C13H13F2N3O2 — CID 61492769
3-imidazol-1-ylpropyl 5-amino-2,4-difluorobenzoate (PubChem CID 61492769) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl 5-amino-2,4-difluorobenzoate.
| Compound Name | 3-imidazol-1-ylpropyl 5-amino-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 61492769 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-imidazol-1-ylpropyl 5-amino-2,4-difluorobenzoate |
| SMILES | Nc1cc(C(=O)OCCCn2ccnc2)c(F)cc1F |
| InChI | InChI=1S/C13H13F2N3O2/c14-10-7-11(15)12(16)6-9(10)13(19)20-5-1-3-18-4-2-17-8-18/h2,4,6-8H,1,3,5,16H2 |
| InChIKey | MZXZRURTWOBGQU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|