C14H20N4O2 — CID 61492877
3-imidazol-1-ylpropyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 61492877) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | 3-imidazol-1-ylpropyl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61492877 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-imidazol-1-ylpropyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCCCn1ccnc1 |
| InChI | InChI=1S/C14H20N4O2/c1-2-5-18-10-12(15)9-13(18)14(19)20-8-3-6-17-7-4-16-11-17/h4,7,9-11H,2-3,5-6,8,15H2,1H3 |
| InChIKey | CUZPACPZZQWEOC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|