C12H20N2O2 — CID 121289390
4-imidazol-1-ylbutyl 2,2-dimethylpropanoate (PubChem CID 121289390) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-imidazol-1-ylbutyl 2,2-dimethylpropanoate.
| Compound Name | 4-imidazol-1-ylbutyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 121289390 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4-imidazol-1-ylbutyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCn1ccnc1 |
| InChI | InChI=1S/C12H20N2O2/c1-12(2,3)11(15)16-9-5-4-7-14-8-6-13-10-14/h6,8,10H,4-5,7,9H2,1-3H3 |
| InChIKey | MMUITKATDNTHQT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|