C16H28N2O2 — CID 123182139
2-imidazol-1-ylethyl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 123182139) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-imidazol-1-ylethyl 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | 2-imidazol-1-ylethyl 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123182139 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-imidazol-1-ylethyl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)OCCn1ccnc1)C(C)(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-15(2,3)11-13(16(4,5)6)14(19)20-10-9-18-8-7-17-12-18/h7-8,12-13H,9-11H2,1-6H3 |
| InChIKey | AYNNFEHMAWSITC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |