C14H24N2O4S — CID 106728792
2-tert-butylsulfonylethyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 106728792) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 2-tert-butylsulfonylethyl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | 2-tert-butylsulfonylethyl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 106728792 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-tert-butylsulfonylethyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-5-6-16-10-11(15)9-12(16)13(17)20-7-8-21(18,19)14(2,3)4/h9-10H,5-8,15H2,1-4H3 |
| InChIKey | BVIKVMPXPGVQJQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |