C16H19FN2O2 — CID 105374637
(5-fluoro-2-methylphenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 105374637) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is (5-fluoro-2-methylphenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | (5-fluoro-2-methylphenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 105374637 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (5-fluoro-2-methylphenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCc1cc(F)ccc1C |
| InChI | InChI=1S/C16H19FN2O2/c1-3-6-19-9-14(18)8-15(19)16(20)21-10-12-7-13(17)5-4-11(12)2/h4-5,7-9H,3,6,10,18H2,1-2H3 |
| InChIKey | OAGZEHXNINCSMK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |