C15H17FN2O2 — CID 61315483
(4-fluorophenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 61315483) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | (4-fluorophenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61315483 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (4-fluorophenyl)methyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN2O2/c1-2-7-18-9-13(17)8-14(18)15(19)20-10-11-3-5-12(16)6-4-11/h3-6,8-9H,2,7,10,17H2,1H3 |
| InChIKey | WAZHCHNHISKCFI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |