C14H23N3O4 — CID 61488139
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 61488139) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61488139 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCC(=O)NC(C)COC |
| InChI | InChI=1S/C14H23N3O4/c1-4-5-17-7-11(15)6-12(17)14(19)21-9-13(18)16-10(2)8-20-3/h6-7,10H,4-5,8-9,15H2,1-3H3,(H,16,18) |
| InChIKey | MPEGJVTUIXABHW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |