C13H22N2O3 — CID 103489505
1-ethoxypropan-2-yl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 103489505) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | 1-ethoxypropan-2-yl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 103489505 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-ethoxypropan-2-yl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OC(C)COCC |
| InChI | InChI=1S/C13H22N2O3/c1-4-6-15-8-11(14)7-12(15)13(16)18-10(3)9-17-5-2/h7-8,10H,4-6,9,14H2,1-3H3 |
| InChIKey | FEZWJPQHOBXIPS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |