C11H18N2O2 — CID 61309440
2-methylpropyl 4-amino-1-ethylpyrrole-2-carboxylate (PubChem CID 61309440) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-methylpropyl 4-amino-1-ethylpyrrole-2-carboxylate.
| Compound Name | 2-methylpropyl 4-amino-1-ethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61309440 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-methylpropyl 4-amino-1-ethylpyrrole-2-carboxylate |
| SMILES | CCn1cc(N)cc1C(=O)OCC(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-4-13-6-9(12)5-10(13)11(14)15-7-8(2)3/h5-6,8H,4,7,12H2,1-3H3 |
| InChIKey | LJUZEYBPNBGSSB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |