C17H31N3O — CID 61106069
4-amino-1-ethyl-N,N-bis(3-methylbutyl)pyrrole-2-carboxamide (PubChem CID 61106069) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is 4-amino-1-ethyl-N,N-bis(3-methylbutyl)pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N,N-bis(3-methylbutyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61106069 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 4-amino-1-ethyl-N,N-bis(3-methylbutyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C17H31N3O/c1-6-19-12-15(18)11-16(19)17(21)20(9-7-13(2)3)10-8-14(4)5/h11-14H,6-10,18H2,1-5H3 |
| InChIKey | KVIJLFFRXBZNLK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |