C10H17N3O2 — CID 93254381
4-amino-1-ethyl-N-[(2S)-1-hydroxypropan-2-yl]pyrrole-2-carboxamide (PubChem CID 93254381) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-[(2S)-1-hydroxypropan-2-yl]pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-[(2S)-1-hydroxypropan-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 93254381 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-amino-1-ethyl-N-[(2S)-1-hydroxypropan-2-yl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C10H17N3O2/c1-3-13-5-8(11)4-9(13)10(15)12-7(2)6-14/h4-5,7,14H,3,6,11H2,1-2H3,(H,12,15)/t7-/m0/s1 |
| InChIKey | YOBNXMBLYOBFQE-ZETCQYMHSA-N |
| XLogP | 0.20 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |