C14H22N2O3 — CID 62383490
oxan-4-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 62383490) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is oxan-4-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate.
| Compound Name | oxan-4-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 62383490 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | oxan-4-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCC1CCOCC1 |
| InChI | InChI=1S/C14H22N2O3/c1-2-5-16-9-12(15)8-13(16)14(17)19-10-11-3-6-18-7-4-11/h8-9,11H,2-7,10,15H2,1H3 |
| InChIKey | UTVQINMYKSKHLL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |