About oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate
oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate (PubChem CID 61309823) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate |
| PubChem CID | 61309823 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(N)cc1C(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C14H22N2O3/c1-2-6-16-9-11(15)8-13(16)14(17)19-10-12-5-3-4-7-18-12/h8-9,12H,2-7,10,15H2,1H3 |
| InChIKey | GRKRUYOKZYCWMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate?
The IUPAC name of oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate (CID 61309823) is oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate.
What is the SMILES notation for oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate?
The canonical SMILES for oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate is CCCn1cc(N)cc1C(=O)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate?
The InChIKey is GRKRUYOKZYCWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-2-6-16-9-11(15)8-13(16)14(17)19-10-12-5-3-4-7-18-12/h8-9,12H,2-7,10,15H2,1H3.
What are the key properties of oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate?
oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate has a molecular weight of 266.34 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 4-amino-1-propylpyrrole-2-carboxylate is sourced from PubChem (CID 61309823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).