C14H20ClNO4S — CID 114611828
cyclopentylmethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate (PubChem CID 114611828) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is cyclopentylmethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate.
| Compound Name | cyclopentylmethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114611828 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | cyclopentylmethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(S(=O)(=O)Cl)cc1C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C14H20ClNO4S/c1-2-7-16-9-12(21(15,18)19)8-13(16)14(17)20-10-11-5-3-4-6-11/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | JLGJLTWDPQVWSC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |