C12H16ClNO5S — CID 114611702
cyclopropylmethyl 4-chlorosulfonyl-1-(2-methoxyethyl)pyrrole-2-carboxylate (PubChem CID 114611702) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is cyclopropylmethyl 4-chlorosulfonyl-1-(2-methoxyethyl)pyrrole-2-carboxylate.
| Compound Name | cyclopropylmethyl 4-chlorosulfonyl-1-(2-methoxyethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114611702 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | cyclopropylmethyl 4-chlorosulfonyl-1-(2-methoxyethyl)pyrrole-2-carboxylate |
| SMILES | COCCn1cc(S(=O)(=O)Cl)cc1C(=O)OCC1CC1 |
| InChI | InChI=1S/C12H16ClNO5S/c1-18-5-4-14-7-10(20(13,16)17)6-11(14)12(15)19-8-9-2-3-9/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | LZSXRWVIXZIFFT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |