C12H16ClNO4S — CID 66322738
cyclopentylmethyl 4-chlorosulfonyl-1-methylpyrrole-2-carboxylate (PubChem CID 66322738) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is cyclopentylmethyl 4-chlorosulfonyl-1-methylpyrrole-2-carboxylate.
| Compound Name | cyclopentylmethyl 4-chlorosulfonyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66322738 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | cyclopentylmethyl 4-chlorosulfonyl-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)Cl)cc1C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C12H16ClNO4S/c1-14-7-10(19(13,16)17)6-11(14)12(15)18-8-9-4-2-3-5-9/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | YAOSUXFFKWBYFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |