C12H17ClN2O4S — CID 65367238
1-methyl-5-(oxan-4-ylmethylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 65367238) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is 1-methyl-5-(oxan-4-ylmethylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-methyl-5-(oxan-4-ylmethylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367238 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-methyl-5-(oxan-4-ylmethylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | Cn1cc(S(=O)(=O)Cl)cc1C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C12H17ClN2O4S/c1-15-8-10(20(13,17)18)6-11(15)12(16)14-7-9-2-4-19-5-3-9/h6,8-9H,2-5,7H2,1H3,(H,14,16) |
| InChIKey | XNYGIMUNKAGUBR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |