C10H13ClN2O3S — CID 65367382
1-methyl-5-[(2-methylcyclopropyl)carbamoyl]pyrrole-3-sulfonyl chloride (PubChem CID 65367382) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 1-methyl-5-[(2-methylcyclopropyl)carbamoyl]pyrrole-3-sulfonyl chloride.
| Compound Name | 1-methyl-5-[(2-methylcyclopropyl)carbamoyl]pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367382 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-methyl-5-[(2-methylcyclopropyl)carbamoyl]pyrrole-3-sulfonyl chloride |
| SMILES | CC1CC1NC(=O)c1cc(S(=O)(=O)Cl)cn1C |
| InChI | InChI=1S/C10H13ClN2O3S/c1-6-3-8(6)12-10(14)9-4-7(5-13(9)2)17(11,15)16/h4-6,8H,3H2,1-2H3,(H,12,14) |
| InChIKey | VCIHFICZRASMNN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |