C10H15ClN2O5S2 — CID 65367473
1-methyl-5-(3-methylsulfonylpropylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 65367473) has the molecular formula C10H15ClN2O5S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 1-methyl-5-(3-methylsulfonylpropylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-methyl-5-(3-methylsulfonylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367473 |
| Molecular Formula | C10H15ClN2O5S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 1-methyl-5-(3-methylsulfonylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | Cn1cc(S(=O)(=O)Cl)cc1C(=O)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C10H15ClN2O5S2/c1-13-7-8(20(11,17)18)6-9(13)10(14)12-4-3-5-19(2,15)16/h6-7H,3-5H2,1-2H3,(H,12,14) |
| InChIKey | WWCNRFURMWIBOG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|