C10H15ClN2O3S — CID 114610913
1-ethyl-5-(propylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114610913) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 1-ethyl-5-(propylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-ethyl-5-(propylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114610913 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-ethyl-5-(propylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CCCNC(=O)c1cc(S(=O)(=O)Cl)cn1CC |
| InChI | InChI=1S/C10H15ClN2O3S/c1-3-5-12-10(14)9-6-8(17(11,15)16)7-13(9)4-2/h6-7H,3-5H2,1-2H3,(H,12,14) |
| InChIKey | WTBHKOGEFKNHAP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |