C10H12ClF3N2O3S — CID 114611390
1-ethyl-5-(3,3,3-trifluoropropylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114611390) has the molecular formula C10H12ClF3N2O3S and a molecular weight of 332.73 g/mol. Its IUPAC name is 1-ethyl-5-(3,3,3-trifluoropropylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-ethyl-5-(3,3,3-trifluoropropylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611390 |
| Molecular Formula | C10H12ClF3N2O3S |
| Molecular Weight | 332.73 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-ethyl-5-(3,3,3-trifluoropropylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CCn1cc(S(=O)(=O)Cl)cc1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2O3S/c1-2-16-6-7(20(11,18)19)5-8(16)9(17)15-4-3-10(12,13)14/h5-6H,2-4H2,1H3,(H,15,17) |
| InChIKey | IRULOFCRSSAOSH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |