C10H17N3O5S2 — CID 61149529
1-methyl-N-(3-methylsulfonylpropyl)-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 61149529) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-methyl-N-(3-methylsulfonylpropyl)-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(3-methylsulfonylpropyl)-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61149529 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-methyl-N-(3-methylsulfonylpropyl)-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C10H17N3O5S2/c1-13-7-8(20(11,17)18)6-9(13)10(14)12-4-3-5-19(2,15)16/h6-7H,3-5H2,1-2H3,(H,12,14)(H2,11,17,18) |
| InChIKey | GYEBTOOPNBKGCY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|