About N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide
N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 104625478) has the molecular formula C13H23N3O4S
and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| PubChem CID | 104625478 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | COCCC(C)(C)CNC(=O)c1cc(S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C13H23N3O4S/c1-13(2,5-6-20-4)9-15-12(17)11-7-10(8-16(11)3)21(14,18)19/h7-8H,5-6,9H2,1-4H3,(H,15,17)(H2,14,18,19) |
| InChIKey | GYPVVYNTNVTAPG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide?
The IUPAC name of N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (CID 104625478) is N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
What is the SMILES notation for N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide?
The canonical SMILES for N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide is COCCC(C)(C)CNC(=O)c1cc(S(N)(=O)=O)cn1C.
What is the InChIKey of N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide?
The InChIKey is GYPVVYNTNVTAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4S/c1-13(2,5-6-20-4)9-15-12(17)11-7-10(8-16(11)3)21(14,18)19/h7-8H,5-6,9H2,1-4H3,(H,15,17)(H2,14,18,19).
What are the key properties of N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide?
N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide has a molecular weight of 317.41 g/mol, XLogP of 0.47, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-2,2-dimethylbutyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide is sourced from PubChem (CID 104625478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).