C11H19N3O3S — CID 61381311
N-(2,2-dimethylpropyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 61381311) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61381311 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2,2-dimethylpropyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C11H19N3O3S/c1-11(2,3)7-13-10(15)9-5-8(6-14(9)4)18(12,16)17/h5-6H,7H2,1-4H3,(H,13,15)(H2,12,16,17) |
| InChIKey | SOLBDGDWMNGELS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |