C10H17N3O4S — CID 60977535
N-(2-ethoxyethyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 60977535) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60977535 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(2-ethoxyethyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCOCCNC(=O)c1cc(S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C10H17N3O4S/c1-3-17-5-4-12-10(14)9-6-8(7-13(9)2)18(11,15)16/h6-7H,3-5H2,1-2H3,(H,12,14)(H2,11,15,16) |
| InChIKey | QUKKYTBZAADRAW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|