C11H17BrN2O2 — CID 43411143
4-bromo-N-(3-ethoxypropyl)-1-methylpyrrole-2-carboxamide (PubChem CID 43411143) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 4-bromo-N-(3-ethoxypropyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3-ethoxypropyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43411143 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-bromo-N-(3-ethoxypropyl)-1-methylpyrrole-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C11H17BrN2O2/c1-3-16-6-4-5-13-11(15)10-7-9(12)8-14(10)2/h7-8H,3-6H2,1-2H3,(H,13,15) |
| InChIKey | MPCLDWDLINQAKI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|