C11H15BrN2O2 — CID 60701929
4-bromo-N-(3-ethenoxypropyl)-1-methylpyrrole-2-carboxamide (PubChem CID 60701929) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 4-bromo-N-(3-ethenoxypropyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3-ethenoxypropyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60701929 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-bromo-N-(3-ethenoxypropyl)-1-methylpyrrole-2-carboxamide |
| SMILES | C=COCCCNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C11H15BrN2O2/c1-3-16-6-4-5-13-11(15)10-7-9(12)8-14(10)2/h3,7-8H,1,4-6H2,2H3,(H,13,15) |
| InChIKey | BIKWIRCCQNVXPS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|