C16H20BrN3O — CID 43411208
4-bromo-1-methyl-N-[3-(N-methylanilino)propyl]pyrrole-2-carboxamide (PubChem CID 43411208) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-[3-(N-methylanilino)propyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-[3-(N-methylanilino)propyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43411208 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-bromo-1-methyl-N-[3-(N-methylanilino)propyl]pyrrole-2-carboxamide |
| SMILES | CN(CCCNC(=O)c1cc(Br)cn1C)c1ccccc1 |
| InChI | InChI=1S/C16H20BrN3O/c1-19(14-7-4-3-5-8-14)10-6-9-18-16(21)15-11-13(17)12-20(15)2/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H,18,21) |
| InChIKey | ZWXABWHWYGDZEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|