C17H20BrN3O3S — CID 25336077
2-bromo-N-[3-(N-methylanilino)propyl]-5-sulfamoylbenzamide (PubChem CID 25336077) has the molecular formula C17H20BrN3O3S and a molecular weight of 426.34 g/mol. Its IUPAC name is 2-bromo-N-[3-(N-methylanilino)propyl]-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[3-(N-methylanilino)propyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 25336077 |
| Molecular Formula | C17H20BrN3O3S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-bromo-N-[3-(N-methylanilino)propyl]-5-sulfamoylbenzamide |
| SMILES | CN(CCCNC(=O)c1cc(S(N)(=O)=O)ccc1Br)c1ccccc1 |
| InChI | InChI=1S/C17H20BrN3O3S/c1-21(13-6-3-2-4-7-13)11-5-10-20-17(22)15-12-14(25(19,23)24)8-9-16(15)18/h2-4,6-9,12H,5,10-11H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | BSSJAFRVTPTLJX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|