C22H30BrN3O3S — CID 32795071
2-bromo-5-(tert-butylsulfamoyl)-N-[3-(N-ethylanilino)propyl]benzamide (PubChem CID 32795071) has the molecular formula C22H30BrN3O3S and a molecular weight of 496.47 g/mol. Its IUPAC name is 2-bromo-5-(tert-butylsulfamoyl)-N-[3-(N-ethylanilino)propyl]benzamide.
| Compound Name | 2-bromo-5-(tert-butylsulfamoyl)-N-[3-(N-ethylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 32795071 |
| Molecular Formula | C22H30BrN3O3S |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-bromo-5-(tert-butylsulfamoyl)-N-[3-(N-ethylanilino)propyl]benzamide |
| SMILES | CCN(CCCNC(=O)c1cc(S(=O)(=O)NC(C)(C)C)ccc1Br)c1ccccc1 |
| InChI | InChI=1S/C22H30BrN3O3S/c1-5-26(17-10-7-6-8-11-17)15-9-14-24-21(27)19-16-18(12-13-20(19)23)30(28,29)25-22(2,3)4/h6-8,10-13,16,25H,5,9,14-15H2,1-4H3,(H,24,27) |
| InChIKey | HZSYZPVMXAGZCJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|