C22H32N4O3S — CID 55743450
5-(tert-butylsulfamoyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-methylbenzamide (PubChem CID 55743450) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-methylbenzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55743450 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-methylbenzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2cc(S(=O)(=O)NC(C)(C)C)ccc2C)cn1 |
| InChI | InChI=1S/C22H32N4O3S/c1-7-26(8-2)20-12-10-17(14-23-20)15-24-21(27)19-13-18(11-9-16(19)3)30(28,29)25-22(4,5)6/h9-14,25H,7-8,15H2,1-6H3,(H,24,27) |
| InChIKey | MXSBQHSGBMFXGL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |