C18H26N4O3S — CID 51155817
5-(tert-butylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-2-methylbenzamide (PubChem CID 51155817) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-2-methylbenzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 51155817 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)cc1C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C18H26N4O3S/c1-14-6-7-15(26(24,25)21-18(2,3)4)12-16(14)17(23)20-8-5-10-22-11-9-19-13-22/h6-7,9,11-13,21H,5,8,10H2,1-4H3,(H,20,23) |
| InChIKey | XTDGONCRSWYYEX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|