C19H27N3O5S — CID 56558667
5-(tert-butylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methylbenzamide (PubChem CID 56558667) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methylbenzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 56558667 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)cc1C(=O)NCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C19H27N3O5S/c1-13-6-7-14(28(26,27)21-19(2,3)4)12-15(13)18(25)20-10-5-11-22-16(23)8-9-17(22)24/h6-7,12,21H,5,8-11H2,1-4H3,(H,20,25) |
| InChIKey | KZJKOKZTQNNUQI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|