C16H26N2O4S — CID 51144217
5-(tert-butylsulfamoyl)-N-(1-methoxypropan-2-yl)-2-methylbenzamide (PubChem CID 51144217) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-(1-methoxypropan-2-yl)-2-methylbenzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-(1-methoxypropan-2-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 51144217 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-(1-methoxypropan-2-yl)-2-methylbenzamide |
| SMILES | COCC(C)NC(=O)c1cc(S(=O)(=O)NC(C)(C)C)ccc1C |
| InChI | InChI=1S/C16H26N2O4S/c1-11-7-8-13(23(20,21)18-16(3,4)5)9-14(11)15(19)17-12(2)10-22-6/h7-9,12,18H,10H2,1-6H3,(H,17,19) |
| InChIKey | UTKDOEHWIZEGPV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |