C14H21BrN2O5S — CID 43006104
2-bromo-5-(2-methoxyethylsulfamoyl)-N-(1-methoxypropan-2-yl)benzamide (PubChem CID 43006104) has the molecular formula C14H21BrN2O5S and a molecular weight of 409.30 g/mol. Its IUPAC name is 2-bromo-5-(2-methoxyethylsulfamoyl)-N-(1-methoxypropan-2-yl)benzamide.
| Compound Name | 2-bromo-5-(2-methoxyethylsulfamoyl)-N-(1-methoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 43006104 |
| Molecular Formula | C14H21BrN2O5S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-bromo-5-(2-methoxyethylsulfamoyl)-N-(1-methoxypropan-2-yl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Br)c(C(=O)NC(C)COC)c1 |
| InChI | InChI=1S/C14H21BrN2O5S/c1-10(9-22-3)17-14(18)12-8-11(4-5-13(12)15)23(19,20)16-6-7-21-2/h4-5,8,10,16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | HYAGRAAXACTWID-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|