C15H21BrN2O6S — CID 56543594
propan-2-yl 2-[[2-bromo-5-(2-methoxyethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 56543594) has the molecular formula C15H21BrN2O6S and a molecular weight of 437.31 g/mol. Its IUPAC name is propan-2-yl 2-[[2-bromo-5-(2-methoxyethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[2-bromo-5-(2-methoxyethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 56543594 |
| Molecular Formula | C15H21BrN2O6S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | propan-2-yl 2-[[2-bromo-5-(2-methoxyethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | COCCNS(=O)(=O)c1ccc(Br)c(C(=O)NCC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C15H21BrN2O6S/c1-10(2)24-14(19)9-17-15(20)12-8-11(4-5-13(12)16)25(21,22)18-6-7-23-3/h4-5,8,10,18H,6-7,9H2,1-3H3,(H,17,20) |
| InChIKey | PIEFXASQFJCMQQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|