C17H25BrN2O5S — CID 96509275
2-bromo-N-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-5-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 96509275) has the molecular formula C17H25BrN2O5S and a molecular weight of 449.37 g/mol. Its IUPAC name is 2-bromo-N-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-5-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | 2-bromo-N-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-5-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 96509275 |
| Molecular Formula | C17H25BrN2O5S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-bromo-N-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-5-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Br)c(C(=O)NC[C@@H]2CCC[C@H](O)C2)c1 |
| InChI | InChI=1S/C17H25BrN2O5S/c1-25-8-7-20-26(23,24)14-5-6-16(18)15(10-14)17(22)19-11-12-3-2-4-13(21)9-12/h5-6,10,12-13,20-21H,2-4,7-9,11H2,1H3,(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | ZKUJEARXMSSBPG-OLZOCXBDSA-N |
| XLogP | 1.65 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|