C18H18BrF3N2O4S — CID 35150998
2-bromo-5-(2-methoxyethylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 35150998) has the molecular formula C18H18BrF3N2O4S and a molecular weight of 495.32 g/mol. Its IUPAC name is 2-bromo-5-(2-methoxyethylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-bromo-5-(2-methoxyethylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 35150998 |
| Molecular Formula | C18H18BrF3N2O4S |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-bromo-5-(2-methoxyethylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Br)c(C(=O)NCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H18BrF3N2O4S/c1-28-8-7-24-29(26,27)14-5-6-16(19)15(10-14)17(25)23-11-12-3-2-4-13(9-12)18(20,21)22/h2-6,9-10,24H,7-8,11H2,1H3,(H,23,25) |
| InChIKey | CXMZLXXHXDJZKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|