C20H26N2O4S — CID 51164465
5-(2-methoxyethylsulfamoyl)-2-methyl-N-[1-(2-methylphenyl)ethyl]benzamide (PubChem CID 51164465) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[1-(2-methylphenyl)ethyl]benzamide.
| Compound Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[1-(2-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 51164465 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[1-(2-methylphenyl)ethyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NC(C)c2ccccc2C)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-14-7-5-6-8-18(14)16(3)22-20(23)19-13-17(10-9-15(19)2)27(24,25)21-11-12-26-4/h5-10,13,16,21H,11-12H2,1-4H3,(H,22,23) |
| InChIKey | LIRUNEDOKIJGOA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|