C18H22N2O3S — CID 43037445
2-methyl-N-[1-(2-methylphenyl)ethyl]-5-(methylsulfamoyl)benzamide (PubChem CID 43037445) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-methyl-N-[1-(2-methylphenyl)ethyl]-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-methyl-N-[1-(2-methylphenyl)ethyl]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43037445 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-methyl-N-[1-(2-methylphenyl)ethyl]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)NC(C)c2ccccc2C)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-12-7-5-6-8-16(12)14(3)20-18(21)17-11-15(10-9-13(17)2)24(22,23)19-4/h5-11,14,19H,1-4H3,(H,20,21) |
| InChIKey | MRHLRGISTCMAJT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |