C16H17N3O5S — CID 35804401
3-[[(2-hydroxybenzoyl)amino]carbamoyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 35804401) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-[[(2-hydroxybenzoyl)amino]carbamoyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | 3-[[(2-hydroxybenzoyl)amino]carbamoyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 35804401 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[[(2-hydroxybenzoyl)amino]carbamoyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)NNC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C16H17N3O5S/c1-10-7-8-11(25(23,24)17-2)9-13(10)16(22)19-18-15(21)12-5-3-4-6-14(12)20/h3-9,17,20H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | NYAQFDQMYGFTPA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|