C18H20N2O5S — CID 51324001
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-(methylsulfamoyl)benzamide (PubChem CID 51324001) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51324001 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)NC(C)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-11-4-6-14(26(22,23)19-3)9-15(11)18(21)20-12(2)13-5-7-16-17(8-13)25-10-24-16/h4-9,12,19H,10H2,1-3H3,(H,20,21) |
| InChIKey | NZYUFSCBJMWURG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |