C19H20N4O4S2 — CID 56503128
5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 56503128) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 56503128 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)Nc2nc(-c3ccccc3)ns2)c1 |
| InChI | InChI=1S/C19H20N4O4S2/c1-13-8-9-15(29(25,26)20-10-11-27-2)12-16(13)18(24)22-19-21-17(23-28-19)14-6-4-3-5-7-14/h3-9,12,20H,10-11H2,1-2H3,(H,21,22,23,24) |
| InChIKey | YXRAGLCMFXOWBA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|