C21H15FN4O3S2 — CID 56503511
2-[(4-fluorophenyl)sulfonylamino]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 56503511) has the molecular formula C21H15FN4O3S2 and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 56503511 |
| Molecular Formula | C21H15FN4O3S2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15FN4O3S2/c22-15-10-12-16(13-11-15)31(28,29)26-18-9-5-4-8-17(18)20(27)24-21-23-19(25-30-21)14-6-2-1-3-7-14/h1-13,26H,(H,23,24,25,27) |
| InChIKey | FHCLFPQVQJMXIR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |