C22H18N4O3S2 — CID 45006642
2-[(4-methylphenyl)sulfonylamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 45006642) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 45006642 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C(=O)Nc2nnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H18N4O3S2/c1-15-11-13-17(14-12-15)31(28,29)26-19-10-6-5-9-18(19)20(27)23-22-25-24-21(30-22)16-7-3-2-4-8-16/h2-14,26H,1H3,(H,23,25,27) |
| InChIKey | MDPUOJGHGDPBSB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |